CAS 112566-18-4

2-Chloroimidazo[1,2-a]pyridine-3-sulfonyl chloride

Description:

2-Chloroimidazo[1,2-a]pyridine-3-sulfonyl chloride is a chemical compound characterized by its imidazo-pyridine structure, which incorporates a chlorine atom and a sulfonyl chloride functional group. This compound typically appears as a solid and is known for its reactivity, particularly due to the presence of the sulfonyl chloride group, which can participate in nucleophilic substitution reactions. It is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to act as a sulfonylating agent. The chlorine atom in the structure enhances its electrophilic character, making it a valuable intermediate in various chemical transformations. Additionally, the compound may exhibit specific solubility properties in organic solvents, which can be influenced by the presence of the sulfonyl chloride group. Safety precautions are necessary when handling this compound, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or other nucleophiles.

Formula: C₇H₄Cl₂N₂O₂S

InChI: InChI=1S/C7H4Cl2N2O2S/c8-6-7(14(9,12)13)11-4-2-1-3-5(11)10-6/h1-4H

InChI key: InChIKey=SKFNUROCOVAKFR-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C=1N2C(=NC1Cl)C=CC=C2

Synonyms:

• Imidazo[1,2-a]pyridine-3-sulfonyl chloride, 2-chloro-
• 2-Chloroimidazo[1,2-a]pyridine-3-sulfonyl chloride