CAS 1125702-54-6
:7,8-Difluoro-2-methoxy-4-quinolinemethanol
Description:
7,8-Difluoro-2-methoxy-4-quinolinemethanol is a chemical compound characterized by its unique quinoline structure, which features two fluorine atoms at the 7 and 8 positions and a methoxy group at the 2 position. This compound is notable for its potential biological activity, particularly in medicinal chemistry, where quinoline derivatives are often explored for their pharmacological properties. The presence of the hydroxymethyl group enhances its solubility and reactivity, making it a candidate for various chemical reactions and applications. Its molecular structure suggests it may interact with biological targets, potentially influencing enzyme activity or receptor binding. The compound's fluorine substituents can also affect its lipophilicity and metabolic stability, which are critical factors in drug design. As with many quinoline derivatives, it may exhibit antimicrobial, antiviral, or anticancer properties, although specific biological activities would need to be confirmed through experimental studies. Overall, 7,8-Difluoro-2-methoxy-4-quinolinemethanol represents a class of compounds with significant interest in both synthetic and medicinal chemistry.
Formula:C11H9F2NO2
InChI:InChI=1S/C11H9F2NO2/c1-16-9-4-6(5-15)7-2-3-8(12)10(13)11(7)14-9/h2-4,15H,5H2,1H3
InChI key:InChIKey=OQYGHEJPTKXFDC-UHFFFAOYSA-N
SMILES:FC=1C2=C(C(CO)=CC(OC)=N2)C=CC1F
Synonyms:- (7,8-Difluoro-2-methoxyquinolin-4-yl)methanol
- 4-Quinolinemethanol, 7,8-difluoro-2-methoxy-
- 7,8-Difluoro-2-methoxy-4-quinolinemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
