CAS 112581-77-8

2,6-DICHLOROIMIDAZO[1,2-B]PYRIDAZINE

Description:

2,6-Dichloroimidazo[1,2-b]pyridazine is a heterocyclic compound characterized by its fused imidazole and pyridazine rings, which incorporate two chlorine substituents at the 2 and 6 positions. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is known for its potential biological activity, making it of interest in pharmaceutical research, particularly in the development of novel therapeutic agents. The presence of chlorine atoms enhances its reactivity and may influence its interaction with biological targets. The compound is generally soluble in organic solvents, but its solubility in water is limited. Its molecular structure contributes to its unique chemical properties, including stability under various conditions, although specific reactivity can depend on the surrounding environment. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity. Overall, 2,6-dichloroimidazo[1,2-b]pyridazine represents a significant compound in the field of medicinal chemistry and materials science.

Formula: C₆H₃Cl₂N₃

InChI: InChI=1/C6H3Cl2N3/c7-4-1-2-6-9-5(8)3-11(6)10-4/h1-3H

SMILES: c1cc2nc(cn2nc1Cl)Cl

Synonyms:

• Imidazo[1,2-B]Pyridazine, 2,6-Dichloro-
• 2,6-Dichloroimidazo[1,2-b]pyridazine

2,6-Dichloroimidazo[1,2-b]pyridazine

CAS: 112581-77-8

Formula: C₆H₃Cl₂N₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 188.0141

Ref: IN-DA00826I

2,6-Dichloroimidazo[1,2-b]pyridazine

CAS: 112581-77-8

2,6-Dichloroimidazo[1,2-b]pyridazine

Purity: 95%

Molecular weight: 188.01g/mol

Ref: 54-OR906339