CAS 112581-95-0

2-bromoimidazo[1,2-a]pyridine

Description:

2-Bromoimidazo[1,2-a]pyridine is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, with a bromine substituent at the 2-position of the imidazole ring. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and dimethylformamide (DMF). It is known for its potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the bromine atom can influence its reactivity, making it a useful intermediate in various chemical syntheses. Additionally, the compound may exhibit properties such as fluorescence or photostability, depending on the specific conditions and environment. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can be significant in biological systems. As with many heterocycles, it may also participate in coordination chemistry, forming complexes with metal ions. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₇H₅BrN₂

InChI: InChI=1/C7H5BrN2/c8-6-5-10-4-2-1-3-7(10)9-6/h1-5H

SMILES: c1ccn2cc(Br)nc2c1

Synonyms:

• Imidazo[1,2-A]Pyridine, 2-Bromo-

2-bromoimidazo[1,2-a]pyridine

CAS: 112581-95-0

Formula: C₇H₅BrN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 197.0320

Ref: IN-DA007SX7

2-Bromoimidazo[1,2-a]pyridine

CAS: 112581-95-0

2-Bromoimidazo[1,2-a]pyridine

Formula: C₇H₅BrN₂

Purity: ≥95%

Color and Shape: white to off-white solid

Molecular weight: 197.03g/mol

Ref: 54-OR301012

2-Bromoimidazo[1,2-a]pyridine

CAS: 112581-95-0

Formula: C₇H₅BrN₂

Purity: 97%

Color and Shape: Solid, White powder

Molecular weight: 197.035

Ref: 10-F076868