
CAS 112582-89-5
:6-chloro-imidazo[2,1-b]thiazole-5-sulfonic acid amide
Description:
6-Chloro-imidazo[2,1-b]thiazole-5-sulfonic acid amide is a chemical compound characterized by its unique structural features, which include an imidazole ring fused to a thiazole moiety, along with a sulfonic acid amide functional group. This compound typically exhibits properties such as high solubility in polar solvents due to the presence of the sulfonic acid group, which can also contribute to its acidic nature. The chlorine substituent on the imidazole ring may influence its reactivity and biological activity, potentially enhancing its interaction with specific biological targets. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to modulate biological pathways. Its molecular structure suggests that it may participate in hydrogen bonding and other intermolecular interactions, which can be critical for its function in biological systems. Overall, 6-chloro-imidazo[2,1-b]thiazole-5-sulfonic acid amide is of interest in various fields, including drug discovery and development.
Formula:C5H4ClN3O2S2
InChI:InChI=1/C5H4ClN3O2S2/c6-3-4(13(7,10)11)9-1-2-12-5(9)8-3/h1-2H,(H2,7,10,11)
SMILES:c1csc2nc(c(n12)S(=O)(=O)N)Cl
Synonyms:- 6-Chloroimidazo[2,1-B][1,3]Thiazole-5-Sulfonamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
6-Chloro-imidazo[2,1-b]thiazole-5-sulphonic acid amide
CAS:6-Chloro-imidazo[2,1-b]thiazole-5-sulphonic acid amidePurity:≥95%Molecular weight:237.69g/mol6-Chloro-imidazo[2,1-b]thiazole-5-sulfonic Acid Amide
CAS:Controlled ProductApplications 6-chloro-imidazo[2,1-b]thiazole-5-sulfonic acid amide (cas# 112582-89-5) is a useful research chemical.
Formula:C5H4N3O2S2ClColor and Shape:NeatMolecular weight:237.696-Chloroimidazo[2,1-b][1,3]thiazole-5-sulfonamide
CAS:6-Chloroimidazo[2,1-b][1,3]thiazole-5-sulfonamide is a skin lightening agent. It is a sulfonamide derivative of imidazoles that inhibits the formation and activity of tyrosinase, an enzyme required for melanin production. 6-Chloroimidazo[2,1-b][1,3]thiazole-5-sulfonamide has been shown to be effective in treating hyperpigmentation in humans. It reduces the color intensity of the skin by decreasing the amount of melanin produced by inhibiting tyrosine hydroxylase activity. This drug also has calcium channel blocking properties which may make it useful in treating abnormal pigmentation due to excessive calcium levels in cells.Formula:C5H4ClN3O2S2Purity:Min. 95%Molecular weight:237.7 g/mol


