CAS 112598-18-2

4-Bromophenoxyacetaldehyde diethylacetal

Description:

4-Bromophenoxyacetaldehyde diethylacetal is an organic compound characterized by its structure, which includes a bromophenyl group, an ether linkage, and an acetal functional group. This compound typically appears as a colorless to pale yellow liquid and is known for its moderate volatility. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic bromophenyl moiety. The presence of the bromine atom imparts unique reactivity, making it useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. The acetal functionality suggests that it can undergo hydrolysis under acidic or basic conditions, releasing the corresponding aldehyde. Additionally, 4-Bromophenoxyacetaldehyde diethylacetal may exhibit biological activity, which can be explored for potential applications in pharmaceuticals or agrochemicals. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and reactivity.

Formula: C₁₂H₁₇BrO₃

InChI: InChI=1/C12H17BrO3/c1-3-14-12(15-4-2)9-16-11-7-5-10(13)6-8-11/h5-8,12H,3-4,9H2,1-2H3

SMILES: CCOC(COc1ccc(cc1)Br)OCC

Synonyms:

• 1-Bromo-4-(2,2-Diethoxyethoxy)Benzene

4-BROMOPHENOXYACETALDEHYDE DIETHYLACETAL

CAS: 112598-18-2

Formula: C₁₂H₁₇BrO₃

Purity: 98%

Molecular weight: 289.1656

Ref: IN-DA007SR0

4-Bromophenoxyacetaldehyde diethylacetal

CAS: 112598-18-2

4-Bromophenoxyacetaldehyde diethylacetal

Formula: C₁₂H₁₇BrO₃

Purity: tech

Color and Shape: clear. colourless & viscous liquid

Molecular weight: 289.17g/mol

Ref: 54-OR10835

1-Bromo-4-(2,2-diethoxyethoxy)benzene

CAS: 112598-18-2

Purity: 95.0%

Molecular weight: 289.16900634765625

Ref: 10-F431146