
CAS 1126-01-8
:3-[(Aminooxy)methyl]-4-bromophenol
Description:
3-[(Aminooxy)methyl]-4-bromophenol, with the CAS number 1126-01-8, is an organic compound characterized by the presence of a bromophenol moiety and an aminooxy functional group. This compound typically appears as a solid and is soluble in polar solvents, reflecting its phenolic structure. The aminooxy group is known for its ability to form stable conjugates with carbonyl compounds, making this substance potentially useful in various chemical reactions, including bioconjugation and as a building block in organic synthesis. The bromine atom in the para position of the phenol ring can serve as a site for further substitution reactions, enhancing its versatility in synthetic applications. Additionally, the presence of the aminooxy group may impart biological activity, making it of interest in medicinal chemistry. Overall, 3-[(Aminooxy)methyl]-4-bromophenol is a compound with unique reactivity and potential applications in both synthetic and biological contexts.
Formula:C7H8BrNO2
InChI:InChI=1S/C7H8BrNO2/c8-7-2-1-6(10)3-5(7)4-11-9/h1-3,10H,4,9H2
InChI key:InChIKey=VEUYLCHWDRJADO-UHFFFAOYSA-N
SMILES:C(ON)C1=C(Br)C=CC(O)=C1
Synonyms:- 3-[(Aminooxy)methyl]-4-bromophenol
- Phenol, 3-[(aminooxy)methyl]-4-bromo-
- Benzyloxyamine, 2-bromo-5-hydroxy-
- m-Cresol, α-(aminooxy)-4-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.