CAS 1126-18-7

2-Butylcyclohexanone

Description:

2-Butylcyclohexanone is a cyclic ketone characterized by a cyclohexane ring with a butyl group and a carbonyl group (C=O) attached to it. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic hydrocarbon structure. The presence of the carbonyl group contributes to its reactivity, making it susceptible to nucleophilic attacks, which can lead to various chemical transformations. 2-Butylcyclohexanone is used in organic synthesis and as an intermediate in the production of other chemical compounds. Its boiling point and melting point are influenced by the molecular structure, and it exhibits moderate volatility. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may cause irritation to the skin and eyes. Overall, 2-butylcyclohexanone is a valuable compound in the field of organic chemistry and industrial applications.

Formula: C₁₀H₁₈O

InChI: InChI=1S/C10H18O/c1-2-3-6-9-7-4-5-8-10(9)11/h9H,2-8H2,1H3

InChI key: InChIKey=POYYYXPQBFPUKS-UHFFFAOYSA-N

SMILES: C(CCC)C1C(=O)CCCC1

Synonyms:

• 2-Butylcyclohexan-1-one
• 2-Butylcyclohexanone
• Cyclohexanone, 2-butyl-
• NSC 60224