CAS 1126-27-8
:4-CYCLOPROPYLBENZONITRILE
Description:
4-Cyclopropylbenzonitrile, with the CAS number 1126-27-8, is an organic compound characterized by a benzene ring substituted with a cyclopropyl group and a nitrile functional group (–C≡N) at the para position. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its aromatic properties due to the presence of the benzene ring, which contributes to its stability and reactivity. The nitrile group imparts polar characteristics, making the compound soluble in polar solvents while being less soluble in nonpolar solvents. 4-Cyclopropylbenzonitrile is of interest in various fields, including pharmaceuticals and materials science, due to its potential as an intermediate in organic synthesis and its role in the development of certain chemical compounds. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Proper storage and handling protocols are essential to ensure safety in laboratory and industrial settings.
Formula:C10H9N
InChI:InChI=1/C10H9N/c11-7-8-1-3-9(4-2-8)10-5-6-10/h1-4,10H,5-6H2
SMILES:c1cc(ccc1C#N)C1CC1
Synonyms:- Akos Bar-1177
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Cyclopropylbenzonitrile
CAS:4-CyclopropylbenzonitrileFormula:C10H9NPurity:≥95%Color and Shape: clear. colourless liquidMolecular weight:143.19g/mol4-Cyclopropylbenzonitrile
CAS:Formula:C10H9NPurity:≥95%Color and Shape:LiquidMolecular weight:143.1894-Cyclopropylbenzonitrile
CAS:4-Cyclopropylbenzonitrile is an electrophilic compound that reacts with a nucleophile to form a covalent bond. The reactivity of 4-cyclopropylbenzonitrile is activated by the addition of chloride. It can be used as a precursor to yield chloroform and other compounds, such as chloride and oxide. 4-Cyclopropylbenzonitrile can also react with sulfur or nitrosyl to form an electrophilic sulfur or nitrosyl compound.
Formula:C10H9NPurity:Min. 95%Molecular weight:143.19 g/mol



