CAS 1126-44-9

2-Thiomethylpyrimidine-4-carboxylic acid

Description:

2-Thiomethylpyrimidine-4-carboxylic acid, with the CAS number 1126-44-9, is a heterocyclic organic compound featuring a pyrimidine ring substituted with a thiomethyl group and a carboxylic acid functional group. This compound typically exhibits characteristics common to pyrimidine derivatives, including potential biological activity due to its ability to interact with various biological targets. It is generally soluble in polar solvents, reflecting the presence of the carboxylic acid group, which can engage in hydrogen bonding. The thiomethyl group may influence the compound's reactivity and stability, potentially enhancing its lipophilicity. 2-Thiomethylpyrimidine-4-carboxylic acid may be utilized in pharmaceutical research and development, particularly in the synthesis of biologically active molecules or as intermediates in organic synthesis. Its specific properties, such as melting point, boiling point, and spectral characteristics, would typically be determined through experimental methods and may vary based on purity and environmental conditions.

Formula: C₆H₆N₂O₂S

InChI: InChI=1/C6H6N2O2S/c1-11-6-7-3-2-4(8-6)5(9)10/h2-3H,1H3,(H,9,10)

SMILES: CSc1nccc(C(=O)O)n1

Synonyms:

• 2-Methylsulfanyl-pyrimidine-4-carboxylic acid
• 2-Methylthiopyrimidine-4-carboxylic acid
• 2-(Methylthio)Pyrimidine-4-Carboxylic Acid
• 2-Methylsulfanylpyrimidine-4-carboxylic acid

2-Methylsulfanylpyrimidine-4-carboxylic acid

CAS: 1126-44-9

Formula: C₆H₆N₂O₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 170.1890

Ref: IN-DA0038YU

2-Methylsulfanylpyrimidine-4-carboxylic acid

CAS: 1126-44-9

2-Methylsulfanylpyrimidine-4-carboxylic acid

Purity: 98%

Molecular weight: 170.19g/mol

Ref: 54-OR80585

2-Methylsulfanylpyrimidine-4-carboxylic acid

CAS: 1126-44-9

Formula: C₆H₆N₂O₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 170.19

Ref: 10-F079907