CAS 1126-47-2

1,2-Dithiolane-3,5-dicarboxylic acid

Description:

1,2-Dithiolane-3,5-dicarboxylic acid, with the CAS number 1126-47-2, is a cyclic dithiolane compound characterized by the presence of two thiol (-SH) groups and two carboxylic acid (-COOH) groups. This compound features a five-membered ring structure that incorporates sulfur atoms, contributing to its unique chemical reactivity and properties. The dithiolane ring enhances the compound's ability to participate in redox reactions, making it of interest in various biochemical applications, particularly in the study of thiol-disulfide exchange reactions. The carboxylic acid groups provide acidic properties, allowing for potential interactions with bases and metal ions. Additionally, the presence of both sulfur and carboxylic acid functionalities suggests that this compound may exhibit antioxidant properties, which could be relevant in biological systems. Its solubility in polar solvents and potential for forming complexes with metal ions further enhance its utility in synthetic and medicinal chemistry. Overall, 1,2-Dithiolane-3,5-dicarboxylic acid is a versatile compound with significant implications in chemical research and applications.

Formula: C₅H₆O₄S₂

InChI: InChI=1S/C5H6O4S2/c6-4(7)2-1-3(5(8)9)11-10-2/h2-3H,1H2,(H,6,7)(H,8,9)

InChI key: InChIKey=OBKGJBFGGPSACP-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CC(C(O)=O)SS1

Synonyms:

• Ph 800/8
• NSC 72272
• 1,2-Dithiolane-3,5-dicarboxylic acid