CymitQuimica logo

CAS 1126-73-4

:

3-(pyridin-3-yl)prop-2-enamide

Description:
3-(Pyridin-3-yl)prop-2-enamide, with the CAS number 1126-73-4, is an organic compound characterized by its structure, which features a pyridine ring attached to a prop-2-enamide moiety. This compound typically exhibits properties associated with both aromatic and unsaturated systems, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the pyridine ring imparts basicity and potential for coordination with metal ions, while the enamide functionality can participate in various chemical reactions, such as nucleophilic additions and cycloadditions. Additionally, this compound may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility characteristics can vary depending on the solvent, and it may display distinct spectral properties in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Overall, 3-(pyridin-3-yl)prop-2-enamide is a versatile compound with potential applications in various fields of chemistry.
Formula:C8H8N2O
InChI:InChI=1/C8H8N2O/c9-8(11)4-3-7-2-1-5-10-6-7/h1-6H,(H2,9,11)
SMILES:c1cc(C=CC(=N)O)cnc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.