
CAS 112626-52-5
:2-(2H-Tetrazol-5-yl)piperidine
Description:
2-(2H-Tetrazol-5-yl)piperidine is a chemical compound characterized by the presence of a piperidine ring and a tetrazole moiety. The piperidine ring is a six-membered saturated heterocycle containing one nitrogen atom, while the tetrazole is a five-membered ring composed of four nitrogen atoms and one carbon atom. This compound exhibits properties typical of both piperidine derivatives and tetrazoles, including potential basicity due to the nitrogen atoms in the piperidine ring and the acidic nature of the tetrazole. It is often studied for its pharmacological properties, as tetrazole-containing compounds can exhibit a range of biological activities, including antimicrobial and anti-inflammatory effects. The presence of the tetrazole group can also enhance solubility and bioavailability. Additionally, 2-(2H-Tetrazol-5-yl)piperidine may serve as a building block in the synthesis of more complex molecules in medicinal chemistry. Its unique structure allows for various modifications, making it a valuable compound in drug discovery and development.
Formula:C6H11N5
InChI:InChI=1S/C6H11N5/c1-2-4-7-5(3-1)6-8-10-11-9-6/h5,7H,1-4H2,(H,8,9,10,11)
InChI key:InChIKey=OYVXVWHWYZMSOE-UHFFFAOYSA-N
SMILES:C=1(NN=NN1)C2CCCCN2
Synonyms:- 2-(1H-Tetrazol-5-yl)-piperidine
- 2-(2H-Tetrazol-5-yl)piperidine
- Piperidine, 2-tetrazol-5-yl-
- Piperidine, 2-(1H-tetrazol-5-yl)-
- Piperidine, 2-(2H-tetrazol-5-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.