
CAS 1126424-63-2
:3-(Bromomethyl)-2-chloro-1,8-naphthyridine
Description:
3-(Bromomethyl)-2-chloro-1,8-naphthyridine is a heterocyclic organic compound characterized by the presence of a naphthyridine ring system, which is a bicyclic structure containing nitrogen atoms. This compound features a bromomethyl group and a chloro substituent, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of halogen atoms (bromine and chlorine) typically enhances the compound's electrophilic character, making it useful in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The naphthyridine core is known for its biological activity, and derivatives of this structure have been investigated for their potential as pharmaceuticals, particularly in the fields of antimicrobial and anticancer agents. Additionally, the compound's solubility, stability, and reactivity can be influenced by the specific substituents and their positions on the naphthyridine ring. Overall, 3-(Bromomethyl)-2-chloro-1,8-naphthyridine represents a versatile building block in synthetic organic chemistry.
Formula:C9H6BrClN2
InChI:InChI=1S/C9H6BrClN2/c10-5-7-4-6-2-1-3-12-9(6)13-8(7)11/h1-4H,5H2
InChI key:InChIKey=UZFRMQVCYQOAPI-UHFFFAOYSA-N
SMILES:C(Br)C1=CC2=C(N=C1Cl)N=CC=C2
Synonyms:- 3-(Bromomethyl)-2-chloro-1,8-naphthyridine
- 1,8-Naphthyridine, 3-(bromomethyl)-2-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.