CAS 1126424-70-1

2-Amino-4-quinolinemethanol

Description:

2-Amino-4-quinolinemethanol is an organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features an amino group (-NH2) and a hydroxymethyl group (-CH2OH) attached to the quinoline ring, contributing to its potential reactivity and biological activity. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the hydroxymethyl and amino groups. The compound may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, making it of interest in medicinal chemistry and drug development. Its specific properties, such as melting point, boiling point, and spectral characteristics, would depend on the purity and specific conditions under which it is studied. Additionally, the compound's biological activity could be explored for potential applications in pharmaceuticals, particularly in the development of agents targeting specific diseases or conditions. Safety data and handling precautions should be considered, as with any chemical substance.

Formula: C₁₀H₁₀N₂O

InChI: InChI=1S/C10H10N2O/c11-10-5-7(6-13)8-3-1-2-4-9(8)12-10/h1-5,13H,6H2,(H2,11,12)

InChI key: InChIKey=JJIMUFJFSKVPES-UHFFFAOYSA-N

SMILES: C(O)C=1C2=C(N=C(N)C1)C=CC=C2

Synonyms:

• (2-Aminoquinolin-4-yl)methanol
• 4-Quinolinemethanol, 2-amino-
• 2-Amino-4-quinolinemethanol