CAS 1126433-42-8
:9H-Fluoren-9-ylmethyl N-[(1S)-2-(1H-benzotriazol-1-yl)-1-[[4-(1,1-dimethylethoxy)phenyl]methyl]-2-oxoethyl]carbamate
Description:
9H-Fluoren-9-ylmethyl N-[(1S)-2-(1H-benzotriazol-1-yl)-1-[[4-(1,1-dimethylethoxy)phenyl]methyl]-2-oxoethyl]carbamate, with CAS number 1126433-42-8, is a synthetic organic compound characterized by its complex structure, which includes a fluorenyl group, a benzotriazole moiety, and a carbamate functional group. This compound is typically used in research and development, particularly in the fields of medicinal chemistry and materials science. Its unique structure may impart specific biological activities or properties, making it of interest for various applications, including potential pharmaceutical uses. The presence of the benzotriazole unit suggests possible UV-absorbing properties, which can be advantageous in formulations requiring photostability. Additionally, the dimethylethoxyphenyl group may enhance solubility and stability in organic solvents. Overall, this compound exemplifies the intricate design often found in modern synthetic chemistry, where multiple functional groups are combined to achieve desired chemical and physical properties.
Formula:C34H32N4O4
InChI:InChI=1S/C34H32N4O4/c1-34(2,3)42-23-18-16-22(17-19-23)20-30(32(39)38-31-15-9-8-14-29(31)36-37-38)35-33(40)41-21-28-26-12-6-4-10-24(26)25-11-5-7-13-27(25)28/h4-19,28,30H,20-21H2,1-3H3,(H,35,40)/t30-/m0/s1
InChI key:InChIKey=CTIHIZJNLXMTHT-PMERELPUSA-N
SMILES:C(OC(N[C@H](C(=O)N1C=2C(N=N1)=CC=CC2)CC3=CC=C(OC(C)(C)C)C=C3)=O)C4C=5C(C=6C4=CC=CC6)=CC=CC5
Synonyms:- Carbamic acid, N-[(1S)-2-(1H-benzotriazol-1-yl)-1-[[4-(1,1-dimethylethoxy)phenyl]methyl]-2-oxoethyl]-, 9H-fluoren-9-ylmethyl ester
- 9H-Fluoren-9-ylmethyl N-[(1S)-2-(1H-benzotriazol-1-yl)-1-[[4-(1,1-dimethylethoxy)phenyl]methyl]-2-oxoethyl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.