CAS 112649-48-6

10H-Dipyrano[3,2-a:2',3'-i]xanthen-14(1H)-one,2,3,11,12-tetrahydro-5,13-dihydroxy-3,3,10,10-tetramethyl-

Description:

10H-Dipyrano[3,2-a:2',3'-i]xanthen-14(1H)-one, 2,3,11,12-tetrahydro-5,13-dihydroxy-3,3,10,10-tetramethyl- is a complex organic compound characterized by its polycyclic structure, which includes multiple fused rings and hydroxyl groups. This compound is part of the xanthenone family, known for their diverse biological activities and potential applications in fields such as photochemistry and medicinal chemistry. The presence of hydroxyl groups contributes to its solubility and reactivity, making it a candidate for various chemical reactions and interactions. The tetramethyl substitution indicates that the compound has four methyl groups attached to its structure, which can influence its physical properties, such as melting point and solubility. Additionally, the compound's unique dipyrano structure may impart specific optical properties, making it of interest for applications in dyes or fluorescent materials. Overall, this compound exemplifies the complexity and versatility of organic molecules in chemical research and application.

Formula: C₂₃H₂₄O₆

InChI: InChI=1S/C23H24O6/c1-22(2)7-5-11-14(28-22)10-16-18(19(11)25)20(26)17-12-6-8-23(3,4)29-21(12)13(24)9-15(17)27-16/h9-10,24-25H,5-8H2,1-4H3

InChI key: InChIKey=QFURCBFEIGTKCW-UHFFFAOYSA-N

SMILES: O=C1C=2C3=C(C(O)=CC2OC=4C1=C(O)C5=C(C4)OC(C)(C)CC5)OC(C)(C)CC3

Synonyms:

• 10H-Dipyrano[3,2-a:2′,3′-i]xanthen-14(1H)-one, 2,3,11,12-tetrahydro-5,13-dihydroxy-3,3,10,10-tetramethyl-
• 2,3,11,12-Tetrahydro-5,13-dihydroxy-3,3,10,10-tetramethyl-10H-dipyrano[3,2-a:2′,3′-i]xanthen-14(1H)-one
• BR-xanthone A
• BR-xanthoneA
• 10H-Dipyrano[3,2-a:2',3'-i]xanthen-14(1H)-one, 2,3,11,12-tetrahydro-5,13-dihydroxy-3,3,10,10-tetramethyl-
• 5,13-Dihydroxy-3,3,10,10-tetramethyl-2,3,11,12-tetrahydro-10H-dipyrano[3,2-a:2',3'-i]xanthen-14(1H)-one

BR-Xanthone A

CAS: 112649-48-6

Formula: C₂₃H₂₄O₆

Color and Shape: Solid

Molecular weight: 396.4331

Ref: IN-DA008YA3

BR-Xanthone A

CAS: 112649-48-6

BR-Xanthone A is a natural product for research related to life sciences. The catalog number is TN3535 and the CAS number is 112649-48-6.

Formula: C₂₃H₂₄O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 396.43

Ref: TM-TN3535

BR-Xanthone A

CAS: 112649-48-6

Formula: C₂₃H₂₄O₆

Purity: 95%~99%

Color and Shape: Yellow powder

Molecular weight: 396.439

Ref: BP-SBP01955

Br-Xanthone A

CAS: 112649-48-6

Br-Xanthone A is a brominated xanthone compound, which is derived from natural sources, particularly from certain plants and marine organisms. Its structure is characterized by a xanthonoid core with bromine substituents, which contributes to its unique biochemical properties.

Formula: C₂₃H₂₄O₆

Purity: Min. 95%

Molecular weight: 396.4 g/mol

Ref: 3D-MEA64948