CAS 112655-19-3: Imidazole-2-carboxaldehyde dimethyl acetal

Description:Imidazole-2-carboxaldehyde dimethyl acetal is a chemical compound characterized by its imidazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features a carboxaldehyde functional group that is protected by two dimethyl acetal groups, enhancing its stability and reactivity in various chemical reactions. Typically, it appears as a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the imidazole moiety suggests potential applications in pharmaceuticals, particularly in the synthesis of biologically active compounds, due to its ability to participate in various chemical transformations. Additionally, the acetal protection allows for selective reactions, making it a valuable intermediate in organic synthesis. Its solubility in organic solvents and moderate stability under standard conditions further contribute to its utility in laboratory settings. As with many chemical substances, handling should be conducted with care, following appropriate safety protocols to mitigate any potential hazards.

Formula:C₆H₁₀N₂O₂

InChI:InChI=1/C6H10N2O2/c1-9-6(10-2)5-7-3-4-8-5/h3-4,6H,1-2H3,(H,7,8)

Synonyms:
2-(Dimethoxymethyl)imidazole
2-(dimethoxymethyl)-1H-imidazole

Found 3 products.

Product data	Purity	Price range	Estimated delivery
IMIDAZOLE-2-CARBOXALDEHYDE DIMETHYL ACETAL REF: IN-DA0079GGCAS: 112655-19-3	- - -	To inquire	Mon 03 Mar 25
2-(Dimethoxymethyl)-1H-imidazole REF: 3D-MEA65519CAS: 112655-19-3	Min. 95%	To inquire	Mon 14 Apr 25
2-(Dimethoxymethyl)-1H-imidazole REF: 10-F735209CAS: 112655-19-3	95+%	- - -	Discontinued product