CAS 1126634-44-3

Methyl 2-cyclopentyl-4-oxazolecarboxylate

Description:

Methyl 2-cyclopentyl-4-oxazolecarboxylate is a chemical compound characterized by its unique oxazole ring structure, which contributes to its potential biological activity. The presence of the cyclopentyl group enhances its hydrophobic characteristics, influencing its solubility and interaction with biological membranes. This compound typically exhibits moderate polarity due to the ester functional group, which can participate in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as oxazole derivatives are often explored for their antimicrobial and anti-inflammatory properties. Additionally, the methyl ester group may enhance the compound's stability and bioavailability. The compound's synthesis and reactivity can be influenced by the presence of the oxazole and cyclopentyl moieties, making it a subject of interest in organic synthesis and drug design. Overall, Methyl 2-cyclopentyl-4-oxazolecarboxylate represents a versatile scaffold for further chemical modifications and investigations in various fields of chemistry and pharmacology.

Formula: C₁₀H₁₃NO₃

InChI: InChI=1S/C10H13NO3/c1-13-10(12)8-6-14-9(11-8)7-4-2-3-5-7/h6-7H,2-5H2,1H3

InChI key: InChIKey=BNQZPVXCIUGUAV-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1N=C(OC1)C2CCCC2

Synonyms:

• 4-Oxazolecarboxylic acid, 2-cyclopentyl-, methyl ester
• Methyl 2-cyclopentyl-4-oxazolecarboxylate