
CAS 112665-42-6
:Ethyl ζ-hydroxybenzeneheptanoate
Description:
Ethyl ζ-hydroxybenzeneheptanoate, also known by its CAS number 112665-42-6, is an organic compound characterized by its ester functional group, which is formed from the reaction of a carboxylic acid and an alcohol. This compound features a heptanoate chain, indicating it has a seven-carbon backbone, and a hydroxybenzene moiety, which suggests the presence of a phenolic structure with a hydroxyl group attached to a benzene ring. The presence of both hydrophobic (the heptanoate chain) and hydrophilic (the hydroxy group) components gives this compound amphiphilic properties, making it potentially useful in various applications, including as a surfactant or emulsifier. Ethyl ζ-hydroxybenzeneheptanoate may also exhibit biological activity, which could be of interest in pharmaceutical or agrochemical research. Its physical properties, such as solubility, boiling point, and melting point, would depend on the specific molecular interactions and the overall structure, which can influence its behavior in different environments.
Formula:C15H22O3
InChI:InChI=1S/C15H22O3/c1-2-18-15(17)12-8-4-7-11-14(16)13-9-5-3-6-10-13/h3,5-6,9-10,14,16H,2,4,7-8,11-12H2,1H3
InChI key:InChIKey=CBLRKMHGDTXYKT-UHFFFAOYSA-N
SMILES:C(CCCCCC(OCC)=O)(O)C1=CC=CC=C1
Synonyms:- Ethyl ζ-hydroxybenzeneheptanoate
- 7-Hydroxy-7-phenylheptanoic acid ethyl ester
- Ethyl 7-hydroxy-7-phenylheptanoate
- Benzeneheptanoic acid, ζ-hydroxy-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
