CAS 112671-42-8

4-bromo-1-iodo-2-nitrobenzene

Description:

4-Bromo-1-iodo-2-nitrobenzene is an aromatic compound characterized by the presence of a bromine atom, an iodine atom, and a nitro group attached to a benzene ring. This compound features a nitro group (-NO2) at the second position, a bromine atom at the fourth position, and an iodine atom at the first position of the benzene ring, making it a polyhalogenated nitrobenzene derivative. It is typically a yellow to brown solid at room temperature and is known for its relatively low solubility in water, but it can dissolve in organic solvents such as ethanol and acetone. The presence of both halogens and a nitro group contributes to its reactivity, making it useful in various chemical syntheses and applications in organic chemistry. Additionally, due to the presence of halogens, it may exhibit unique properties such as increased electrophilicity, which can influence its behavior in substitution reactions. Safety precautions should be taken when handling this compound, as it may pose health risks due to its halogenated nature.

Formula: C₆H₃BrINO₂

InChI: InChI=1/C6H3BrINO2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H

SMILES: c1cc(c(cc1Br)N(=O)=O)I

Synonyms:

• Benzene, 4-Bromo-1-Iodo-2-Nitro-

4-Bromo-1-iodo-2-nitrobenzene

CAS: 112671-42-8

Formula: C₆H₃BrINO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 327.9020

Ref: IN-DA007SJ2

5-Bromo-2-iodonitrobenzene

CAS: 112671-42-8

5-Bromo-2-iodonitrobenzene

Formula: C₆H₃BrINO₂

Purity: 99%

Color and Shape: amber to orange powder

Molecular weight: 327.90g/mol

Ref: 54-OR17993

4-Bromo-1-iodo-2-nitrobenzene

CAS: 112671-42-8

Formula: C₆H₃BrINO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 327.903

Ref: 10-F093053