CAS 112677-07-3

3-(Dimethylamino)-1-(2-furanyl)-2-methyl-2-propen-1-one

Description:

3-(Dimethylamino)-1-(2-furanyl)-2-methyl-2-propen-1-one, also known by its CAS number 112677-07-3, is an organic compound characterized by its unique structure that includes a dimethylamino group and a furan ring. This compound typically exhibits properties associated with both the furan moiety and the α,β-unsaturated carbonyl functionality. It is likely to be a yellow to orange solid or liquid, depending on its purity and specific conditions. The presence of the dimethylamino group suggests potential basicity and reactivity, making it a candidate for various chemical reactions, including nucleophilic additions. Additionally, the furan ring can contribute to its aromatic character and potential for electrophilic substitution reactions. This compound may find applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to its structural features that can influence biological activity. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate risks associated with its use.

Formula: C₁₀H₁₃NO₂

InChI: InChI=1S/C10H13NO2/c1-8(7-11(2)3)10(12)9-5-4-6-13-9/h4-7H,1-3H3

InChI key: InChIKey=YWFIVJBIVRJQSK-UHFFFAOYSA-N

SMILES: C(C(=CN(C)C)C)(=O)C1=CC=CO1

Synonyms:

• 3-(Dimethylamino)-1-(2-furanyl)-2-methyl-2-propen-1-one
• 2-Propen-1-one, 3-(dimethylamino)-1-(2-furanyl)-2-methyl-