CAS 112677-28-8
:Guanidine, (3,5-dimethylphenyl)-
Description:
Guanidine, (3,5-dimethylphenyl)-, also known by its CAS number 112677-28-8, is an organic compound characterized by the presence of a guanidine functional group attached to a 3,5-dimethylphenyl moiety. This compound typically exhibits properties associated with guanidine derivatives, such as being a strong base due to the presence of the guanidine group, which can participate in proton transfer reactions. The 3,5-dimethylphenyl substituent contributes to its hydrophobic character and may influence its solubility and reactivity in various solvents. The compound may also display biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential interactions with biological targets, which could lead to applications in medicinal chemistry. Additionally, guanidine derivatives are often studied for their roles in catalysis and as intermediates in organic synthesis. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity and reactivity.
Formula:C9H13N3
InChI:InChI=1S/C9H13N3/c1-6-3-7(2)5-8(4-6)12-9(10)11/h3-5H,1-2H3,(H4,10,11,12)
InChI key:CHAFZGUGLLKKQE-UHFFFAOYSA-N
SMILES:CC1=CC(=CC(=C1)N=C(N)N)C
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery