CAS 1126779-31-4

4-Bromo-2-chloro-5-fluorobenzamide

Description:

4-Bromo-2-chloro-5-fluorobenzamide is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with three halogen atoms (bromine, chlorine, and fluorine) and an amide functional group. The presence of these halogens contributes to its unique chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests that it could participate in nucleophilic substitution reactions due to the electrophilic nature of the carbonyl carbon in the amide group. Additionally, the halogen substituents can influence the compound's electronic properties, potentially affecting its biological activity. Safety data sheets should be consulted for handling and toxicity information, as halogenated compounds can pose environmental and health risks. Overall, 4-Bromo-2-chloro-5-fluorobenzamide is a compound of interest for further research and development in synthetic chemistry.

Formula: C₇H₄BrClFNO

InChI: InChI=1S/C7H4BrClFNO/c8-4-2-5(9)3(7(11)12)1-6(4)10/h1-2H,(H2,11,12)

InChI key: InChIKey=XIGJCJHMVFAJJZ-UHFFFAOYSA-N

SMILES: C(N)(=O)C1=C(Cl)C=C(Br)C(F)=C1

Synonyms:

• 4-Bromo-2-chloro-5-fluorobenzamide
• Benzamide, 4-bromo-2-chloro-5-fluoro-
• 2-Chloro-4-bromo-5-fluorobenzamide