CAS 1126848-36-9

5-Iodo-2-methoxy-4-pyrimidinamine

Description:

5-Iodo-2-methoxy-4-pyrimidinamine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of an iodine atom at the 5-position and a methoxy group (-OCH3) at the 2-position contributes to its unique reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents due to the methoxy group, while its iodine substituent can influence its electronic properties and reactivity. The amino group at the 4-position enhances its potential for forming hydrogen bonds, making it a candidate for various biological interactions. Its structural features suggest potential use in the development of pharmaceuticals, particularly in targeting specific biological pathways. As with many halogenated compounds, care should be taken regarding its handling and disposal due to potential environmental and health impacts.

Formula: C₅H₆IN₃O

InChI: InChI=1S/C5H6IN3O/c1-10-5-8-2-3(6)4(7)9-5/h2H,1H3,(H2,7,8,9)

InChI key: InChIKey=IYZRCGBZOHKARJ-UHFFFAOYSA-N

SMILES: O(C)C=1N=C(N)C(I)=CN1

Synonyms:

• 5-Iodo-2-methoxy-4-pyrimidinamine
• 4-Pyrimidinamine, 5-iodo-2-methoxy-