CAS 112693-21-7
:2-(4-hydroxyphenyl)ethyl 2,6-bis-O-{[(2S,3E)-3-ethylidene-2-(beta-D-glucopyranosyloxy)-5-(methoxycarbonyl)-3,4-dihydro-2H-pyran-4-yl]acetyl}-beta-D-glucopyranoside
Description:
The chemical substance known as 2-(4-hydroxyphenyl)ethyl 2,6-bis-O-{[(2S,3E)-3-ethylidene-2-(beta-D-glucopyranosyloxy)-5-(methoxycarbonyl)-3,4-dihydro-2H-pyran-4-yl]acetyl}-beta-D-glucopyranoside, with the CAS number 112693-21-7, is a complex glycoside. It features multiple functional groups, including hydroxyl, ether, and ester functionalities, which contribute to its solubility and reactivity. The presence of glucopyranoside units indicates that it is a carbohydrate derivative, suggesting potential biological activity, possibly as a natural product or a synthetic analog. The structure includes a phenolic moiety, which may impart antioxidant properties. Additionally, the compound's stereochemistry, particularly the presence of chiral centers, may influence its biological interactions and pharmacological effects. Such compounds are often studied for their potential applications in pharmaceuticals, nutraceuticals, and as bioactive agents in various fields, including medicine and agriculture. Further characterization through techniques like NMR, mass spectrometry, and chromatography would provide insights into its purity and structural integrity.
Formula:C48H64O27
InChI:InChI=1/C48H64O27/c1-5-22-24(26(42(62)64-3)17-68-44(22)74-46-39(60)36(57)33(54)28(15-49)70-46)13-31(52)67-19-30-35(56)38(59)41(48(72-30)66-12-11-20-7-9-21(51)10-8-20)73-32(53)14-25-23(6-2)45(69-18-27(25)43(63)65-4)75-47-40(61)37(58)34(55)29(16-50)71-47/h5-10,17-18,24-25,28-30,33-41,44-51,54-61H,11-16,19H2,1-4H3/b22-5+,23-6+/t24?,25?,28-,29-,30-,33-,34-,35-,36+,37+,38+,39-,40-,41-,44+,45+,46+,47+,48-/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Oleonuezhenide
CAS:Oleonuezhenide is a natural product from Chinese formula Ligustrum lucidum, exerts neuroprotective effects and also considered as treatment of osteoporosis.Formula:C48H64O27Purity:98.06% - 99.25%Color and Shape:SolidMolecular weight:1073.01Oleonuezhenide
CAS:<p>Oleonuezhenide is a bioactive compound, specifically a secoiridoid glycoside, which is derived from the fruit and leaves of the medicinal plant Ligustrum lucidum, commonly known as Chinese privet. This source, a member of the Oleaceae family, has been traditionally used in herbal medicine practices across Asia for various therapeutic purposes.</p>Formula:C48H64O27Purity:Min. 95%Molecular weight:1,073 g/mol






