CymitQuimica logo

CAS 112696-91-0

:

2-METHYL-N1-[4-(3-PYRIDINYL)-2-PYRIMIDINYL]-1,4-BENZENEDIAMINE

Description:
2-Methyl-N1-[4-(3-pyridinyl)-2-pyrimidinyl]-1,4-benzenediamine, with the CAS number 112696-91-0, is a chemical compound characterized by its complex structure, which includes a benzene ring, a pyrimidine moiety, and a pyridine group. This compound is typically classified as an organic amine due to the presence of amino groups (-NH2) attached to the benzene ring. It exhibits properties such as potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of multiple heterocycles suggests that it may interact with various biological targets, possibly influencing pathways related to cell signaling or enzyme inhibition. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its application in research or pharmaceutical formulations. Additionally, the compound's molecular weight and specific functional groups contribute to its reactivity and potential applications in synthetic organic chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C16H15N5
InChI:InChI=1/C16H15N5/c1-11-9-13(17)4-5-14(11)20-16-19-8-6-15(21-16)12-3-2-7-18-10-12/h2-10H,17H2,1H3,(H,19,20,21)
SMILES:Cc1cc(ccc1Nc1nccc(c2cccnc2)n1)N
Synonyms:
  • 1,4-benzenediamine, 2-methyl-N1-[4-(3-pyridinyl)-2-pyrimidinyl]-
  • 2-Methyl-N1-[4-(pyridin-3-yl)pyrimidin-2-yl]benzene-1,4-diamine
  • 2-methyl-N-[4-(3-pyridyl)pyrimidin-2-yl]benzene-1,4-diamine
  • 2-Methyl-N1-[4-(3-pyridinyl)-2-pyrimidinyl]-1,4-benzenediamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.