CAS 1127-59-9: 7-Methylisatin
Description:7-Methylisatin is an organic compound belonging to the class of isatins, which are derived from indole and characterized by a diketone structure. It features a methyl group at the 7-position of the isatin ring, which influences its chemical reactivity and biological properties. The molecular formula of 7-Methylisatin is typically represented as C9H7N1O2, indicating the presence of a nitrogen atom and two oxygen atoms in its structure. This compound is known for its potential applications in medicinal chemistry, particularly due to its reported antimicrobial, anticancer, and anti-inflammatory activities. 7-Methylisatin can undergo various chemical reactions, including oxidation and substitution, making it a versatile intermediate in organic synthesis. Its solubility varies depending on the solvent, and it is generally more soluble in polar organic solvents. As with many isatin derivatives, 7-Methylisatin's properties can be influenced by the presence of substituents, making it a subject of interest for further research in drug development and material science.
Formula:C9H7NO2
InChI:InChI=1S/C9H7NO2/c1-5-3-2-4-6-7(5)10-9(12)8(6)11/h2-4H,1H3,(H,10,11,12)
InChI key:InChIKey=UEHZKEABUOAZSH-UHFFFAOYSA-N
SMILES:O=C1NC=2C(=CC=CC2C)C1=O
- Synonyms:
- 1H-Indole-2,3-dione, 7-methyl-
- 1H-Indole-2,3-dione, 7-methyl- (9CI)
- 7-Methyl-2,3-dihydro-2,3-dioxoindole
- 7-Methyl-2,3-indolinedione
- 7-Methyl-indole-2,3-dione
- 7-Methylisatin
- Ai3-61860
- Brn 0128145
- Indole-2,3-dione, 7-methyl-
- Isatin, 7-methyl-
- See more synonyms
- Nsc 3161
- 5-21-11-00183 (Beilstein Handbook Reference)
- 7-Methyl-1H-indole-2,3-dione
