CAS 1127-93-1
:2,4-Diaminopteridine
Description:
2,4-Diaminopteridine is an organic compound characterized by its bicyclic structure, which includes a pteridine ring system. It features two amino groups (-NH2) located at the 2 and 4 positions of the pteridine ring, contributing to its basicity and reactivity. This compound is typically a yellow to orange crystalline solid and is soluble in polar solvents such as water and alcohols. 2,4-Diaminopteridine is of interest in biochemical research, particularly in the study of folate metabolism and as a potential intermediate in the synthesis of various pharmaceuticals. Its structural similarity to folic acid allows it to interact with enzymes involved in nucleic acid synthesis. Additionally, it may exhibit biological activity, making it a subject of investigation in medicinal chemistry. Safety data indicates that, like many amines, it should be handled with care due to potential toxicity and irritant properties. Overall, 2,4-Diaminopteridine serves as a valuable compound in both synthetic and biological chemistry contexts.
Formula:C6H6N6
InChI:InChI=1/C6H6N6/c7-4-3-5(10-2-1-9-3)12-6(8)11-4/h1-2H,(H4,7,8,10,11,12)
SMILES:c1cnc2c(c(N)[nH]c(=N)n2)n1
Synonyms:- 2,4-Pteridinediamine
- Pteridine-2,4-Diamine
- 2,4-diaminopteridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Pteridine-2,4-diamine
CAS:Pteridine-2,4-diamine is a peroxide that is found in nature. It has been shown to have an inhibitory effect on mutant enzymes that are involved in the production of hydrogen peroxide. Pteridine-2,4-diamine binds to a ligand and prevents it from reacting with hydrogen peroxide. This compound is used as a surfactant in pharmaceutical preparations. It also has an inhibitory effect on soybean lipoxygenase, which may be due to its ability to bind to the phosphonium salt at the active site and prevent the catalytic reaction with hydrogen peroxide.
Formula:C6H6N6Purity:Min. 95%Molecular weight:162.15 g/mol
