CAS 112720-39-5
:D-TERT-LEUCINE HYDROCHLORIDE
Description:
D-tert-leucine hydrochloride is a chiral amino acid derivative, specifically the D-enantiomer of tert-leucine, which is a branched-chain amino acid. It is characterized by its white crystalline appearance and is soluble in water, making it suitable for various biochemical applications. The presence of the hydrochloride group enhances its solubility and stability in aqueous solutions. D-tert-leucine is often utilized in peptide synthesis and as a building block in the development of pharmaceuticals, particularly in the design of drugs that require specific stereochemistry. Its unique structure contributes to its role in influencing the conformation and activity of peptides. Additionally, it may exhibit specific biological activities, although its primary use is in research and synthesis rather than as a therapeutic agent. As with many amino acids, it is important to handle D-tert-leucine hydrochloride with care, following appropriate safety protocols to avoid any potential hazards associated with chemical handling.
Formula:C6H14ClNO2
InChI:InChI=1/C6H13NO2.ClH/c1-6(2,3)4(7)5(8)9;/h4H,7H2,1-3H3,(H,8,9);1H/t4-;/m1./s1
SMILES:CC(C)(C)[C@@H](C(=O)O)N.Cl
Synonyms:- D-Tertleucine.HCl
- (R)-2-amino-3,3-dimethylbutanoic acid hydrochlorid
- (1R)-1-carboxy-2,2-dimethylpropan-1-aminium chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
