CAS 112726-97-3
:5-amino-2-[2-(dimethylnitroryl)ethyl]-1H-benzo[de]isoquinoline-1,3(2H)-dione
Description:
5-amino-2-[2-(dimethylnitroyl)ethyl]-1H-benzo[de]isoquinoline-1,3(2H)-dione, with the CAS number 112726-97-3, is a synthetic organic compound characterized by its complex structure, which includes an isoquinoline core and a nitro group. This compound features an amino group that contributes to its potential reactivity and biological activity. The presence of the dimethylnitroyl group suggests that it may exhibit unique electronic properties, influencing its interactions in chemical reactions or biological systems. The isoquinoline moiety is known for its occurrence in various natural products and pharmaceuticals, often associated with diverse biological activities. The compound's solubility, stability, and reactivity can vary based on its molecular structure and the functional groups present. As with many synthetic compounds, its applications may span medicinal chemistry, materials science, or as a research tool in biochemical studies. However, specific data regarding its toxicity, pharmacokinetics, or detailed applications would require further investigation through experimental studies or literature reviews.
Formula:C16H17N3O3
InChI:InChI=1/C16H17N3O3/c1-19(2,22)7-6-18-15(20)12-5-3-4-10-8-11(17)9-13(14(10)12)16(18)21/h3-5,8-9H,6-7,17H2,1-2H3
SMILES:CN(=O)(C)CCn1c(=O)c2cccc3cc(cc(c23)c1=O)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
