CAS 112734-21-1

4-Bromo-2-nitrobenzoyl chloride

Description:

4-Bromo-2-nitrobenzoyl chloride is an organic compound characterized by its functional groups, which include a bromine atom, a nitro group, and an acyl chloride. This compound typically appears as a yellow to orange solid or liquid, depending on its purity and form. It is known for its reactivity, particularly due to the presence of the acyl chloride functional group, which makes it a useful intermediate in organic synthesis, especially in the preparation of various pharmaceuticals and agrochemicals. The nitro group contributes to its electrophilic properties, enhancing its ability to participate in substitution reactions. Additionally, the bromine atom can serve as a site for further functionalization. 4-Bromo-2-nitrobenzoyl chloride is generally handled with care due to its potential to release hydrochloric acid upon hydrolysis and its classification as a hazardous material. Proper safety measures, including the use of personal protective equipment and working in a well-ventilated area or fume hood, are essential when working with this compound.

Formula: C₇H₃BrClNO₃

InChI: InChI=1S/C7H3BrClNO3/c8-4-1-2-5(7(9)11)6(3-4)10(12)13/h1-3H

InChI key: InChIKey=NTHPXJQLZIGPLM-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C1=C(N(=O)=O)C=C(Br)C=C1

Synonyms:

• Benzoyl chloride, 4-bromo-2-nitro-
• 4-Bromo-2-nitrobenzoyl chloride

4-Bromo-2-nitrobenzoyl chloride

CAS: 112734-21-1

Formula: C₇H₃BrClNO₃

Purity: 95%

Color and Shape: Liquid

Molecular weight: 264.4606

Ref: IN-DA01FOX6

4-Bromo-2-nitrobenzoyl chloride

CAS: 112734-21-1

4-Bromo-2-nitrobenzoyl chloride

Purity: 95%

Molecular weight: 264.46g/mol

Ref: 54-OR1052083