CymitQuimica logo

CAS 112748-45-5

:

2,4-DICHLORO-6-(3-FLUOROPHENOXY)-1,3,5-TRIAZINE

Description:
2,4-Dichloro-6-(3-fluorophenoxy)-1,3,5-triazine is a chemical compound characterized by its triazine ring structure, which is a six-membered heterocyclic compound containing three nitrogen atoms. This substance features two chlorine atoms and a fluorophenoxy group, contributing to its unique chemical properties. It is typically used as an herbicide, particularly in agricultural applications, due to its ability to inhibit specific biochemical pathways in plants. The presence of halogen atoms (chlorine and fluorine) enhances its biological activity and stability. The compound is generally considered to have low solubility in water but may exhibit higher solubility in organic solvents. Its mode of action involves interference with photosynthesis and other metabolic processes in target plants. Safety and handling precautions are essential when working with this compound, as it may pose environmental risks and potential toxicity to non-target organisms. Proper storage conditions and adherence to regulatory guidelines are crucial for its use in agricultural practices.
Formula:C9H4Cl2FN3O
InChI:InChI=1/C9H4Cl2FN3O/c10-7-13-8(11)15-9(14-7)16-6-3-1-2-5(12)4-6/h1-4H
SMILES:c1cc(cc(c1)Oc1nc(Cl)nc(Cl)n1)F
Synonyms:
  • Salor-Int L446548-1Ea
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.