CAS 112748-46-6

2,4-Dichloro-6-(4-fluorophenoxy)-1,3,5-triazine

Description:

2,4-Dichloro-6-(4-fluorophenoxy)-1,3,5-triazine is a synthetic organic compound characterized by its triazine ring structure, which is a six-membered aromatic heterocycle containing three nitrogen atoms. This compound features two chlorine substituents at the 2 and 4 positions and a 4-fluorophenoxy group at the 6 position, contributing to its chemical reactivity and potential applications. It is typically used in agricultural chemistry, particularly as a herbicide, due to its ability to inhibit specific biochemical pathways in plants. The presence of halogen atoms enhances its biological activity and stability. In terms of physical properties, it is generally a solid at room temperature, with low solubility in water but higher solubility in organic solvents. Safety data indicates that it should be handled with care, as it may pose environmental and health risks if not managed properly. Overall, its unique structure and properties make it a significant compound in the field of agrochemicals.

Formula: C₉H₄Cl₂FN₃O

InChI: InChI=1S/C9H4Cl2FN3O/c10-7-13-8(11)15-9(14-7)16-6-3-1-5(12)2-4-6/h1-4H

InChI key: InChIKey=AXBBKPROLZJRKM-UHFFFAOYSA-N

SMILES: O(C=1N=C(Cl)N=C(Cl)N1)C2=CC=C(F)C=C2

Synonyms:

• 1,3,5-Triazine, 2,4-dichloro-6-(4-fluorophenoxy)-
• Salor-Int L446599-1Ea
• 2,4-Dichloro-6-(4-fluorophenoxy)-1,3,5-triazine

2,4-Dichloro-6-(4-fluorophenoxy)-1,3,5-triazine

CAS: 112748-46-6

2,4-Dichloro-6-(4-fluorophenoxy)-1,3,5-triazine

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 260.05g/mol

Ref: 54-PC7086