
CAS 112749-53-8
:1-(2-Ethoxyphenyl)-2,5-pyrrolidinedione
Description:
1-(2-Ethoxyphenyl)-2,5-pyrrolidinedione, identified by its CAS number 112749-53-8, is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and an ethoxy-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and cyclic structures, contributing to its potential reactivity and stability. It may display moderate solubility in organic solvents, reflecting the influence of its ethoxy group, while its pyrrolidine moiety can participate in various chemical reactions, including nucleophilic attacks and cyclization processes. The presence of the dione functional groups suggests that it may engage in tautomeric equilibria and could act as a potential electrophile in organic synthesis. Additionally, compounds of this nature may possess biological activity, making them of interest in medicinal chemistry and drug development. However, specific applications and biological effects would require further investigation and characterization through empirical studies.
Formula:C12H13NO3
InChI:InChI=1S/C12H13NO3/c1-2-16-10-6-4-3-5-9(10)13-11(14)7-8-12(13)15/h3-6H,2,7-8H2,1H3
InChI key:InChIKey=RFBJONHMLWBEPI-UHFFFAOYSA-N
SMILES:O=C1N(C(=O)CC1)C2=C(OCC)C=CC=C2
Synonyms:- 2,5-Pyrrolidinedione, 1-(2-ethoxyphenyl)-
- 1-(2-Ethoxyphenyl)-2,5-pyrrolidinedione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.