CAS 112758-89-1

tert-butyl2-(piperazin-1-yl)ethylcarbamate

Description:

Tert-butyl 2-(piperazin-1-yl)ethylcarbamate is a chemical compound characterized by its unique structure, which includes a tert-butyl group, a piperazine moiety, and a carbamate functional group. This compound typically exhibits properties associated with both amines and carbamates, such as potential solubility in polar solvents and the ability to form hydrogen bonds due to the presence of the carbamate group. The piperazine ring contributes to its basicity and may influence its biological activity, making it of interest in medicinal chemistry. The tert-butyl group enhances lipophilicity, which can affect the compound's pharmacokinetics and interaction with biological membranes. Additionally, the compound may exhibit specific reactivity patterns typical of carbamates, such as susceptibility to hydrolysis under certain conditions. Overall, tert-butyl 2-(piperazin-1-yl)ethylcarbamate is a versatile compound with potential applications in pharmaceuticals, particularly in the development of drugs targeting central nervous system disorders or other therapeutic areas.

Formula: C₁₃H₁₄N₂

InChI: InChI=1/C13H14N2/c1-2-5-11(6-3-1)13-12-7-4-9-15(12)10-8-14-13/h1-7,9,13-14H,8,10H2

SMILES: c1ccc(cc1)C1c2cccn2CCN1

Synonyms:

• 1-Phenyl-1,2,3,4-Tetrahydropyr
• 1-Phenyl-1,2,3,4-Tetrahydropyrrolo[1,2-A]Pyrazine

1-Phenyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine

CAS: 112758-89-1

Formula: C₁₃H₁₄N₂

Color and Shape: Solid

Molecular weight: 198.2637

Ref: IN-DA008USU

1-Phenyl-1,2,3,4-tetrahydro-pyrrolo[1,2-a]pyrazine

CAS: 112758-89-1

Formula: C₁₃H₁₄N₂

Purity: 95.0%

Molecular weight: 198.269

Ref: 10-F059221