CymitQuimica logo

CAS 112758-90-4

:

1,2,3,4-Tetrahydro-1-(4-methoxyphenyl)pyrrolo[1,2-a]pyrazine

Description:
1,2,3,4-Tetrahydro-1-(4-methoxyphenyl)pyrrolo[1,2-a]pyrazine is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes a pyrrole and a pyrazine moiety. This compound features a tetrahydro configuration, indicating the presence of four hydrogen atoms that saturate the cyclic structure, contributing to its stability and reactivity. The methoxyphenyl group attached to the nitrogen atom enhances its lipophilicity and may influence its biological activity. Typically, compounds of this nature are studied for their potential pharmacological properties, including neuroactivity and interactions with various biological targets. The presence of both nitrogen-containing rings suggests potential for diverse chemical reactivity, making it a candidate for further synthetic modifications. Additionally, the compound's solubility and stability in various solvents can vary, which is crucial for its application in medicinal chemistry and drug development. Overall, 1,2,3,4-Tetrahydro-1-(4-methoxyphenyl)pyrrolo[1,2-a]pyrazine represents a significant structure in the realm of organic and medicinal chemistry.
Formula:C14H16N2O
InChI:InChI=1S/C14H16N2O/c1-17-12-6-4-11(5-7-12)14-13-3-2-9-16(13)10-8-15-14/h2-7,9,14-15H,8,10H2,1H3
InChI key:InChIKey=BHUFGJNASUNOHC-UHFFFAOYSA-N
SMILES:O(C)C1=CC=C(C2C=3N(CCN2)C=CC3)C=C1
Synonyms:
  • Pyrrolo[1,2-a]pyrazine, 1,2,3,4-tetrahydro-1-(4-methoxyphenyl)-
  • 1,2,3,4-Tetrahydro-1-(4-methoxyphenyl)pyrrolo[1,2-a]pyrazine
  • 1-(4-Methoxyphenyl)-1H,2H,3H,4H-pyrrolo[1,2-a]pyrazine
  • 1-(4-Methoxyphenyl)-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.