
CAS 112764-31-5
:5-[2-(Propylthio)phenyl]-1,3,4-thiadiazol-2-amine
Description:
5-[2-(Propylthio)phenyl]-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and a propylthio group attached to a phenyl moiety. This compound features a thiadiazole core, which is a five-membered heterocyclic ring containing two nitrogen atoms and three carbon atoms, contributing to its potential biological activity. The presence of the propylthio group enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. The amine functional group at the 2-position of the thiadiazole ring may participate in hydrogen bonding, affecting its reactivity and interaction with other molecules. This compound is of interest in medicinal chemistry and material science due to its potential applications in pharmaceuticals and agrochemicals. Its specific properties, such as melting point, solubility, and reactivity, would depend on the surrounding conditions and the presence of other functional groups in a given formulation. Overall, 5-[2-(Propylthio)phenyl]-1,3,4-thiadiazol-2-amine represents a versatile scaffold for further chemical exploration and development.
Formula:C11H13N3S2
InChI:InChI=1S/C11H13N3S2/c1-2-7-15-9-6-4-3-5-8(9)10-13-14-11(12)16-10/h3-6H,2,7H2,1H3,(H2,12,14)
InChI key:InChIKey=XDMGGAOLTDHYBI-UHFFFAOYSA-N
SMILES:S(CCC)C1=C(C=CC=C1)C=2SC(N)=NN2
Synonyms:- 1,3,4-Thiadiazol-2-amine, 5-[2-(propylthio)phenyl]-
- 5-[2-(Propylthio)phenyl]-1,3,4-thiadiazol-2-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.