
CAS 112766-35-5
:3-(Methoxymethyl)-α,α-dimethylbenzenemethanol
Description:
3-(Methoxymethyl)-α,α-dimethylbenzenemethanol, identified by its CAS number 112766-35-5, is an organic compound characterized by its complex structure, which includes a benzene ring substituted with a methoxymethyl group and two methyl groups at the alpha positions. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It exhibits moderate solubility in organic solvents, while its solubility in water is limited due to the hydrophobic nature of the aromatic ring. The presence of the methoxymethyl group contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, its structure suggests potential applications in the synthesis of more complex organic molecules or as an intermediate in pharmaceutical or agrochemical production. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H16O2
InChI:InChI=1S/C11H16O2/c1-11(2,12)10-6-4-5-9(7-10)8-13-3/h4-7,12H,8H2,1-3H3
InChI key:InChIKey=ULQSANLEBJPPGQ-UHFFFAOYSA-N
SMILES:C(C)(C)(O)C1=CC(COC)=CC=C1
Synonyms:- Benzenemethanol, 3-(methoxymethyl)-α,α-dimethyl-
- 2-[3-(Methoxymethyl)phenyl]propan-2-ol
- 3-(Methoxymethyl)-α,α-dimethylbenzenemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.