CAS 112776-83-7

Diethyl 4-bromopyridine-2,6-dicarboxylate

Description:

Diethyl 4-bromopyridine-2,6-dicarboxylate is an organic compound characterized by its pyridine ring substituted with bromine and two ester functional groups. The presence of the bromine atom at the 4-position of the pyridine ring enhances its reactivity, making it a useful intermediate in various chemical syntheses. The two diethyl ester groups at the 2 and 6 positions contribute to its solubility in organic solvents and influence its chemical behavior, particularly in reactions involving nucleophiles. This compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its molecular structure allows for potential applications in medicinal chemistry, agrochemicals, and as a building block in the synthesis of more complex molecules. Additionally, the presence of the carboxylate groups can facilitate further functionalization, making it a versatile compound in organic synthesis. Safety data should be consulted for handling, as halogenated compounds can pose health risks.

Formula: C₁₁H₁₂BrNO₄

InChI: InChI=1/C11H12BrNO4/c1-3-16-10(14)8-5-7(12)6-9(13-8)11(15)17-4-2/h5-6H,3-4H2,1-2H3

SMILES: CCOC(=O)c1cc(cc(C(=O)OCC)n1)Br

Synonyms:

• Diethyl 4-bromo-2,6-pyridinedicarboxylate

2,6-Pyridinedicarboxylicacid, 4-bromo-, 2,6-diethyl ester

CAS: 112776-83-7

Formula: C₁₁H₁₂BrNO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 302.1213

Ref: IN-DA0081UI

4-Bromo-2,6-pyridinedicarboxylic acid ethyl ester

CAS: 112776-83-7

4-Bromo-2,6-pyridinedicarboxylic acid ethyl ester is a luminescent compound that emits light in the visible region of the spectrum. It can be used as a ligand for polymerized monolayers or as a bifunctional covalent coupling agent. The carboxylate group on 4-Bromo-2,6-pyridinedicarboxylic acid ethyl ester interacts with lanthanide metal ions to produce luminescence. This chemical also has low frequency emission and can be used for supramolecular interactions.

Formula: C₁₁H₁₂BrNO₄

Purity: Min. 95%

Molecular weight: 302.12 g/mol

Ref: 3D-FB146116