CAS 112777-31-8

3-Methyl-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one

Description:

3-Methyl-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both a pyridine and an oxazine moiety. This compound features a methyl group at the 3-position of the pyridine ring, contributing to its chemical properties and reactivity. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. The presence of the oxazinone functional group suggests potential reactivity, particularly in nucleophilic substitution or cyclization reactions. This compound may also display biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its behavior in biological systems. As with many heterocycles, the stability and reactivity of 3-Methyl-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one can be affected by substituents and environmental conditions, making it a subject of interest for further research in organic synthesis and pharmacology.

Formula: C₈H₈N₂O₂

InChI: InChI=1S/C8H8N2O2/c1-5-7(11)10-6-3-2-4-9-8(6)12-5/h2-5H,1H3,(H,10,11)

InChI key: InChIKey=SGXRJMPCRXELRU-UHFFFAOYSA-N

SMILES: O=C1NC=2C(OC1C)=NC=CC2

Synonyms:

• 3-Methyl-1H,2H,3H-pyrido[2,3-b][1,4]oxazin-2-one
• 1H-Pyrido[2,3-b][1,4]oxazin-2(3H)-one, 3-methyl-
• 3-Methyl-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one

3-Methyl-1H,2H,3H-pyrido[2,3-b][1,4]oxazin-2-one

CAS: 112777-31-8

Versatile small molecule scaffold

Formula: C₈H₈N₂O₂

Purity: Min. 95%

Molecular weight: 164.16 g/mol

Ref: 3D-MEA77731