
CAS 112794-33-9
:7,8-Dichloro-1,2,3,4-tetrahydro-3-isoquinolinemethanol
Description:
7,8-Dichloro-1,2,3,4-tetrahydro-3-isoquinolinemethanol is a chemical compound characterized by its complex bicyclic structure, which includes a tetrahydroisoquinoline framework. The presence of two chlorine atoms at the 7 and 8 positions contributes to its unique reactivity and potential biological activity. This compound features a hydroxymethyl group, which can influence its solubility and interaction with biological targets. It is typically a solid at room temperature and may exhibit moderate to high polarity due to the hydroxymethyl group. The dichloro substitution can enhance its lipophilicity, affecting its pharmacokinetic properties. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as isoquinoline derivatives are known for various biological activities, including antitumor and antimicrobial effects. Safety and handling precautions should be observed due to the presence of chlorine, which can pose health risks. As with any chemical, thorough characterization and understanding of its properties are essential for its application in research or industry.
Formula:C10H11Cl2NO
InChI:InChI=1S/C10H11Cl2NO/c11-9-2-1-6-3-7(5-14)13-4-8(6)10(9)12/h1-2,7,13-14H,3-5H2
InChI key:InChIKey=BYNFMAOUMAKLOM-UHFFFAOYSA-N
SMILES:ClC1=C2C(CC(CO)NC2)=CC=C1Cl
Synonyms:- (7,8-Dichloro-1,2,3,4-tetrahydroisoquinolin-3-yl)methanol
- 3-Isoquinolinemethanol, 7,8-dichloro-1,2,3,4-tetrahydro-
- 7,8-Dichloro-1,2,3,4-tetrahydro-3-isoquinolinemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.