
CAS 1128-46-7
:1,5-Dihydro-4,1-benzothiazepin-2(3H)-one
Description:
1,5-Dihydro-4,1-benzothiazepin-2(3H)-one, with the CAS number 1128-46-7, is a heterocyclic compound characterized by a benzothiazepine structure. This compound features a fused benzene and thiazepine ring system, which contributes to its unique chemical properties. It typically exhibits a range of biological activities, making it of interest in medicinal chemistry. The presence of the carbonyl group in the 2-position of the thiazepine ring can influence its reactivity and interactions with biological targets. Additionally, the compound may display moderate solubility in organic solvents, while its solubility in water can vary depending on the specific conditions. The molecular structure allows for potential interactions with various receptors and enzymes, which is significant for its pharmacological applications. Overall, 1,5-Dihydro-4,1-benzothiazepin-2(3H)-one is a compound of interest for further research in drug development and therapeutic applications.
Formula:C9H9NOS
InChI:InChI=1S/C9H9NOS/c11-9-6-12-5-7-3-1-2-4-8(7)10-9/h1-4H,5-6H2,(H,10,11)
InChI key:InChIKey=JOGGWBCSSCRGPG-UHFFFAOYSA-N
SMILES:O=C1NC=2C(CSC1)=CC=CC2
Synonyms:- 1,2,3,5-Tetrahydro-4,1-benzothiazepin-2-one
- 4,1-Benzothiazepin-2(3H)-one, 1,5-dihydro-
- 1,5-Dihydro-4,1-benzothiazepin-2(3H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.