CAS 1128-74-1
:7-FLUORO-2-METHYLQUINOLINE
Description:
7-Fluoro-2-methylquinoline is an organic compound belonging to the quinoline family, characterized by a bicyclic structure that consists of a fused benzene and pyridine ring. The presence of a fluorine atom at the 7-position and a methyl group at the 2-position contributes to its unique chemical properties. This compound typically exhibits a pale yellow to light brown appearance and is known for its aromatic nature, which can influence its reactivity and interactions with other substances. It is generally soluble in organic solvents, reflecting its non-polar characteristics, while its polar functional groups may allow for some degree of solubility in polar solvents. 7-Fluoro-2-methylquinoline is of interest in various fields, including medicinal chemistry, due to its potential biological activities and applications in the synthesis of pharmaceuticals. Additionally, its fluorine substitution can enhance lipophilicity and metabolic stability, making it a valuable compound for research and development in drug discovery. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C10H5F4N
InChI:InChI=1/C10H5F4N/c11-7-3-1-6-2-4-9(10(12,13)14)15-8(6)5-7/h1-5H
SMILES:c1cc(cc2c1ccc(C(F)(F)F)n2)F
Synonyms:- 7-Fluoroquinaldine
- 2-Methyl-7-Fluoroquinoline
- 7-FLUORO-2-METHYLQUINOLINE 98+%;7-fluoro-2-methylquinoline
- 7-Fluoro-2-(Trifluoromethyl)Quinoline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
7-Fluoro-2-methylquinoline
CAS:Formula:C10H8FNPurity:97%Color and Shape:SolidMolecular weight:161.17567-Fluoro-2-methylquinoline
CAS:Formula:C10H8FNPurity:>98.0%(T)Color and Shape:White to Yellow to Orange powder to crystalMolecular weight:161.187-Fluoro-2-methylquinoline
CAS:7-Fluoro-2-methylquinolineFormula:C10H8FNPurity:98%Color and Shape: light brown solidMolecular weight:161.18g/mol7-Fluoro-2-methylquinoline
CAS:Formula:C10H8FNPurity:98%Color and Shape:SolidMolecular weight:161.1797-Fluoro-2-methylquinoline
CAS:7-Fluoro-2-methylquinoline is a multistep synthetic compound that belongs to the family of quinoxalines. It has been shown to have potent antibacterial activity against a wide range of bacteria, including methicillin-resistant Staphylococcus aureus (MRSA) and Mycobacterium tuberculosis. 7-Fluoro-2-methylquinoline was developed as an analog of the natural product quinoxaline. The key step in its synthesis is the reaction between an aldehyde and hydroxyalkylating reagent in the presence of iron catalyst. This process results in the formation of functional groups such as hydroxyls, alkoxy, or halogens.Formula:C10H8FNPurity:Min. 95%Color and Shape:White PowderMolecular weight:161.18 g/mol




