CAS 1128-87-6
:1-piperidinobutane-1,3-dione
Description:
1-Piperidinobutane-1,3-dione, with the CAS number 1128-87-6, is an organic compound characterized by its piperidine ring and a butanedione structure. This substance features a piperidine moiety, which is a six-membered ring containing one nitrogen atom, and two carbonyl groups (C=O) located at the first and third positions of a butane chain. The presence of these functional groups contributes to its reactivity and potential applications in organic synthesis. Typically, 1-piperidinobutane-1,3-dione exhibits properties such as being a solid at room temperature, with moderate solubility in polar solvents due to its polar carbonyl groups. It may participate in various chemical reactions, including nucleophilic additions and cyclization, making it useful in the synthesis of more complex molecules. Additionally, its derivatives may have biological activity, which can be explored in medicinal chemistry. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H15NO2
InChI:InChI=1/C9H15NO2/c1-8(11)7-9(12)10-5-3-2-4-6-10/h2-7H2,1H3
SMILES:CC(=O)CC(=O)N1CCCCC1
Synonyms:- 1-Acetoacetylpiperidine
- 1-(Piperidin-1-Yl)Butane-1,3-Dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
