
CAS 1128-92-3
:2-(3-Methyl-2-buten-1-yl)phenol
Description:
2-(3-Methyl-2-buten-1-yl)phenol, also known as 3-Methyl-2-butenylphenol, is an organic compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) attached to a phenyl ring. This compound features a branched alkyl side chain, specifically a 3-methyl-2-butenyl group, contributing to its unique reactivity and properties. It is typically a colorless to pale yellow liquid with a characteristic odor. The presence of the phenolic hydroxyl group imparts certain polar characteristics, making it soluble in organic solvents while exhibiting limited solubility in water. This compound is known for its potential applications in the synthesis of various chemical intermediates, fragrances, and as a potential antioxidant. Additionally, it may exhibit biological activity, which can be of interest in pharmaceutical research. As with many organic compounds, handling should be done with care, considering safety data sheets for proper guidelines on toxicity and environmental impact.
Formula:C11H14O
InChI:InChI=1S/C11H14O/c1-9(2)7-8-10-5-3-4-6-11(10)12/h3-7,12H,8H2,1-2H3
InChI key:InChIKey=GLOBOHBQKQLVIS-UHFFFAOYSA-N
SMILES:C(C=C(C)C)C1=C(O)C=CC=C1
Synonyms:- 2-(3-Methyl-2-buten-1-yl)phenol
- 1-(2-Hydroxyphenyl)-3-methylbut-2-ene
- Phenol, o-(3-methyl-2-butenyl)-
- Phenol, 2-(3-methyl-2-buten-1-yl)-
- Phenol, 2-(3-methyl-2-butenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.