CAS 112809-54-8
:4-(1H-IMIDAZOL-1-YLMETHYL)BENZONITRILE
Description:
4-(1H-Imidazol-1-ylmethyl)benzonitrile, with the CAS number 112809-54-8, is an organic compound characterized by its structure, which features a benzene ring substituted with a nitrile group and an imidazole moiety linked through a methylene bridge. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the imidazole ring, which is known for its role in various biochemical processes. The nitrile group contributes to its polarity and can influence solubility in organic solvents. Additionally, the compound may display interesting reactivity patterns, making it a candidate for applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be studied for its interactions with biological targets or its utility in material science. Overall, 4-(1H-imidazol-1-ylmethyl)benzonitrile represents a versatile structure with potential implications in various fields of research.
Formula:C11H9N3
InChI:InChI=1/C11H9N3/c12-7-10-1-3-11(4-2-10)8-14-6-5-13-9-14/h1-6,9H,8H2
SMILES:c1cc(ccc1C#N)Cn1ccnc1
Synonyms:- 4-(1H-Imidazol-1-ylmethyl)benzonitrile 97%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-(Imidazol-1-ylmethyl)benzonitrile
CAS:Formula:C11H9N3Purity:98%Color and Shape:SolidMolecular weight:183.20934-(1H-Imidazol-1-ylmethyl)benzonitrile
CAS:<p>4-(1H-Imidazol-1-ylmethyl)benzonitrile is a ligand that is used in coordination chemistry. It has been shown to inhibit the activity of carboxylate enzymes, such as aconitase and malate dehydrogenase. This compound binds to the terminal residues on these enzymes, which are hydrophobic and contain a carboxyl group. The coordination geometry of 4-(1H-imidazol-1-ylmethyl)benzonitrile is octahedral, with six ligands binding to the metal ion. The luminescence of this molecule is due to its fluorescence properties when excited by light at 365 nm.</p>Formula:C11H9N3Purity:Min. 95%Molecular weight:183.21 g/mol



