CAS 112809-57-1
:4,4'-(Chloromethylene)-bis-benzonitrile
Description:
4,4'-(Chloromethylene)-bis-benzonitrile, with the CAS number 112809-57-1, is an organic compound characterized by its structure, which features two benzonitrile groups connected by a chloromethylene bridge. This compound typically appears as a solid at room temperature and is known for its potential applications in various fields, including materials science and organic synthesis. The presence of the nitrile functional groups (-C≡N) imparts notable chemical properties, such as the ability to participate in nucleophilic reactions and serve as a precursor for further chemical modifications. Additionally, the chloromethylene moiety can influence the compound's reactivity and stability. While specific physical properties such as melting point, boiling point, and solubility may vary, compounds of this nature often exhibit moderate solubility in organic solvents. Safety data should be consulted, as compounds containing chlorine and nitrile groups may pose health and environmental risks. Overall, 4,4'-(Chloromethylene)-bis-benzonitrile is a significant compound in synthetic chemistry with diverse potential applications.
Formula:C15H9ClN2
InChI:InChI=1/C15H9ClN2/c16-15(13-5-1-11(9-17)2-6-13)14-7-3-12(10-18)4-8-14/h1-8,15H
SMILES:c1cc(ccc1C#N)C(c1ccc(cc1)C#N)Cl
Synonyms:- 4-[A-(4-Cyanophenyl)-Chloromethyl]Benzonitrile
- 4-Alpha-(4-Cyanophenyl)-Chloromethyl-Benzonitrile
- 4-[ α - (4-CYANOPHENYL)-CHLOROMETHYL]BENZONITRILE(MEDIATE FOR LETROZOLE)
- 4-[a-(4-Cyanophenyl)-chloromethyl]-benzonitrile(ForLetrozole)
- 4-α-(4-Cyanophenyl)chloromethylbenzonitrile
- 4-[α-(4-Cyanophenyl)-chloromethyl]-benzonitrile ( For Letrozole )
- 4,4'-(Chloromethanediyl)Dibenzonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.