CAS 112811-65-1
:2,4,5-Trifluoro-3-methoxybenzoic acid
Description:
2,4,5-Trifluoro-3-methoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of three fluorine atoms and a methoxy group attached to a benzoic acid framework. The trifluoromethyl groups at the 2, 4, and 5 positions significantly influence its chemical properties, enhancing its acidity and lipophilicity. The methoxy group at the 3-position contributes to its overall polarity and can affect its reactivity and solubility in various solvents. This compound is typically a solid at room temperature and exhibits moderate stability under standard conditions. It is often utilized in organic synthesis and pharmaceutical applications due to its unique electronic properties and potential biological activity. The presence of fluorine atoms can also impart distinctive characteristics such as increased metabolic stability and altered pharmacokinetics in drug development. As with many fluorinated compounds, safety precautions should be taken when handling this substance, as it may pose environmental and health risks.
Formula:C8H5F3O3
InChI:InChI=1S/C8H5F3O3/c1-14-7-5(10)3(8(12)13)2-4(9)6(7)11/h2H,1H3,(H,12,13)
InChI key:InChIKey=YVJHZWWMKFQKDC-UHFFFAOYSA-N
SMILES:O(C)C1=C(F)C(C(O)=O)=CC(F)=C1F
Synonyms:- 2,4,5-Trifluoro-3-Methoxybenzoate
- 2,4,5-Trifluoro-3-methoxybenzoic acid
- 2,4-Difluoro-3-Methylbenzoyl Chloride
- 3-Methoxy-2,4,5-Trifluorobenzoic Acid
- Benzoic acid, 2,4,5-trifluoro-3-methoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,4,5-Trifluoro-3-methoxybenzoic Acid
CAS:Formula:C8H5F3O3Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:206.123-Methoxy-2,4,5-trifluorobenzoic acid
CAS:3-Methoxy-2,4,5-trifluorobenzoic acidPurity:98%Color and Shape:SolidMolecular weight:206.12g/mol3-Methoxy-2,4,5-trifluorobenzoic acid
CAS:3-Methoxy-2,4,5-trifluorobenzoic acid (3MTBF) is a ligand that binds to the active site of bacterial dehydrogenases. It is used to inhibit the growth of bacteria in the environment and food products. 3MTBF inhibits the production of fluoroquinolones by methylating their chlorides with methoxy groups. This compound also has bifunctional properties, as it can act as both a methylating agent and an inhibitor of dehydrogenase enzymes. 3MTBF inhibits the production of cancer cells by inhibiting transcription and translation, preventing cell division and proliferation. 3MTBF is thermostable, meaning it does not break down in high temperatures or at pH extremes.
Formula:C8H5F3O3Purity:Min. 95%Color and Shape:White to off-white solid.Molecular weight:206.12 g/mol2,4,5-Trifluoro-3-methoxybenzoic acid
CAS:Formula:C8H5F3O3Purity:97%Color and Shape:Solid, White powderMolecular weight:206.12





