CAS 112822-79-4
:5-Bromo-2,4-difluoro-3-methylbenzenamine
Description:
5-Bromo-2,4-difluoro-3-methylbenzenamine, with the CAS number 112822-79-4, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a bromine atom, two fluorine atoms, and an amino group. The presence of these substituents influences its chemical properties, such as reactivity and polarity. The bromine and fluorine atoms are electronegative, which can enhance the compound's ability to participate in electrophilic aromatic substitution reactions. The amino group (-NH2) contributes to the compound's basicity and can engage in hydrogen bonding, affecting its solubility in various solvents. This compound may be of interest in pharmaceutical chemistry and materials science due to its potential applications in drug development and as an intermediate in organic synthesis. Additionally, the specific arrangement of substituents can lead to unique biological activities, making it a candidate for further research in medicinal chemistry. Safety data should be consulted for handling and usage, as halogenated compounds can exhibit varying degrees of toxicity.
Formula:C7H6BrF2N
InChI:InChI=1S/C7H6BrF2N/c1-3-6(9)4(8)2-5(11)7(3)10/h2H,11H2,1H3
InChI key:InChIKey=ANPBREPSXQLUIF-UHFFFAOYSA-N
SMILES:FC1=C(C)C(F)=C(N)C=C1Br
Synonyms:- 5-Bromo-2,4-difluoro-3-methylaniline
- Benzenamine, 5-bromo-2,4-difluoro-3-methyl-
- 5-Bromo-2,4-difluoro-3-methylbenzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.